C26H34F22IP — CID 146503666
dihexyl-bis(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)phosphanium iodide (PubChem CID 146503666) has the molecular formula C26H34F22IP and a molecular weight of 922.39 g/mol. Its IUPAC name is dihexyl-bis(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)phosphanium iodide.
| Compound Name | dihexyl-bis(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)phosphanium iodide |
|---|---|
| PubChem CID | 146503666 |
| Molecular Formula | C26H34F22IP |
| Molecular Weight | 922.39 g/mol |
| Exact Mass | 922.11 |
| IUPAC Name | dihexyl-bis(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)phosphanium iodide |
| SMILES | CCCCCC[P+](CCCCCC)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[I-] |
| InChI | InChI=1S/C26H34F22P.HI/c1-3-5-7-9-13-49(14-10-8-6-4-2,15-11-17(27,28)19(31,32)21(35,36)23(39,40)25(43,44)45)16-12-18(29,30)20(33,34)22(37,38)24(41,42)26(46,47)48;/h3-16H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | SQOCYUILLQIYGG-UHFFFAOYSA-M |
| XLogP | 10.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.39 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|