C12H17F10P — CID 22348772
1,1,1,2,2,3,3,4,4,5-decafluorododecan-5-ylphosphane (PubChem CID 22348772) has the molecular formula C12H17F10P and a molecular weight of 382.22 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5-decafluorododecan-5-ylphosphane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5-decafluorododecan-5-ylphosphane |
|---|---|
| PubChem CID | 22348772 |
| Molecular Formula | C12H17F10P |
| Molecular Weight | 382.22 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5-decafluorododecan-5-ylphosphane |
| SMILES | CCCCCCCC(F)(P)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H17F10P/c1-2-3-4-5-6-7-8(13,23)9(14,15)10(16,17)11(18,19)12(20,21)22/h2-7,23H2,1H3 |
| InChIKey | DURYQILTPXAUDD-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.22 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|