C28H21F39P+ — CID 101408345
butyl-tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phosphanium (PubChem CID 101408345) has the molecular formula C28H21F39P+ and a molecular weight of 1129.37 g/mol. Its IUPAC name is butyl-tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phosphanium.
| Compound Name | butyl-tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phosphanium |
|---|---|
| PubChem CID | 101408345 |
| Molecular Formula | C28H21F39P+ |
| Molecular Weight | 1129.37 g/mol |
| Exact Mass | 1129.08 |
| IUPAC Name | butyl-tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phosphanium |
| SMILES | CCCC[P+](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C28H21F39P/c1-2-3-7-68(8-4-11(29,30)14(35,36)17(41,42)20(47,48)23(53,54)26(59,60)61,9-5-12(31,32)15(37,38)18(43,44)21(49,50)24(55,56)27(62,63)64)10-6-13(33,34)16(39,40)19(45,46)22(51,52)25(57,58)28(65,66)67/h2-10H2,1H3/q+1 |
| InChIKey | PEJCAMAUWYKMOH-UHFFFAOYSA-N |
| XLogP | 16.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 24 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1129.37 |
| LogP ≤ 5 | 16.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|