C10H10F13NOS — CID 87198529
1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfinyl)ethanamine (PubChem CID 87198529) has the molecular formula C10H10F13NOS and a molecular weight of 439.24 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfinyl)ethanamine.
| Compound Name | 1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfinyl)ethanamine |
|---|---|
| PubChem CID | 87198529 |
| Molecular Formula | C10H10F13NOS |
| Molecular Weight | 439.24 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfinyl)ethanamine |
| SMILES | CC(N)S(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F13NOS/c1-4(24)26(25)3-2-5(11,12)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)23/h4H,2-3,24H2,1H3 |
| InChIKey | XRXDPQOYKWXFHQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|