C26H28F26O7S2 — CID 11468798
1-[2-[2-[2-hydroxy-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfinyl)propoxy]ethoxy]ethoxy]-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfinyl)propan-2-ol (PubChem CID 11468798) has the molecular formula C26H28F26O7S2 and a molecular weight of 1010.58 g/mol. Its IUPAC name is 1-[2-[2-[2-hydroxy-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfinyl)propoxy]ethoxy]ethoxy]-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfinyl)propan-2-ol.
| Compound Name | 1-[2-[2-[2-hydroxy-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfinyl)propoxy]ethoxy]ethoxy]-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfinyl)propan-2-ol |
|---|---|
| PubChem CID | 11468798 |
| Molecular Formula | C26H28F26O7S2 |
| Molecular Weight | 1010.58 g/mol |
| Exact Mass | 1010.09 |
| IUPAC Name | 1-[2-[2-[2-hydroxy-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfinyl)propoxy]ethoxy]ethoxy]-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfinyl)propan-2-ol |
| SMILES | O=S(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(O)COCCOCCOCC(O)CS(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C26H28F26O7S2/c27-15(28,17(31,32)19(35,36)21(39,40)23(43,44)25(47,48)49)1-7-60(55)11-13(53)9-58-5-3-57-4-6-59-10-14(54)12-61(56)8-2-16(29,30)18(33,34)20(37,38)22(41,42)24(45,46)26(50,51)52/h13-14,53-54H,1-12H2 |
| InChIKey | NSRVVDDNTJEABP-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1010.58 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|