C12H12F14O3 — CID 142737839
1-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-3-(2,2,3,3,3-pentafluoropropoxy)propan-2-ol (PubChem CID 142737839) has the molecular formula C12H12F14O3 and a molecular weight of 470.20 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-3-(2,2,3,3,3-pentafluoropropoxy)propan-2-ol.
| Compound Name | 1-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-3-(2,2,3,3,3-pentafluoropropoxy)propan-2-ol |
|---|---|
| PubChem CID | 142737839 |
| Molecular Formula | C12H12F14O3 |
| Molecular Weight | 470.20 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 1-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-3-(2,2,3,3,3-pentafluoropropoxy)propan-2-ol |
| SMILES | OC(COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)COCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H12F14O3/c13-7(14,9(17,18)10(19,20)12(24,25)26)1-2-28-3-6(27)4-29-5-8(15,16)11(21,22)23/h6,27H,1-5H2 |
| InChIKey | PWTMMQYTSBMDCF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.20 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|