C19H14F26O2 — CID 172565177
5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-4,4-dimethyl-1-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)decan-2-ol (PubChem CID 172565177) has the molecular formula C19H14F26O2 and a molecular weight of 768.27 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-4,4-dimethyl-1-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)decan-2-ol.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-4,4-dimethyl-1-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)decan-2-ol |
|---|---|
| PubChem CID | 172565177 |
| Molecular Formula | C19H14F26O2 |
| Molecular Weight | 768.27 g/mol |
| Exact Mass | 768.06 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-4,4-dimethyl-1-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)decan-2-ol |
| SMILES | CC(C)(CC(O)COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H14F26O2/c1-7(2,9(22,23)11(26,27)13(30,31)15(34,35)17(38,39)19(43,44)45)3-6(46)4-47-5-8(20,21)10(24,25)12(28,29)14(32,33)16(36,37)18(40,41)42/h6,46H,3-5H2,1-2H3 |
| InChIKey | DOJCNBFGHSGTOI-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.27 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|