C11H10F14O3 — CID 98454538
1,3-bis(2,2,3,3,4,4,4-heptafluorobutoxy)propan-2-ol (PubChem CID 98454538) has the molecular formula C11H10F14O3 and a molecular weight of 456.17 g/mol. Its IUPAC name is 1,3-bis(2,2,3,3,4,4,4-heptafluorobutoxy)propan-2-ol.
| Compound Name | 1,3-bis(2,2,3,3,4,4,4-heptafluorobutoxy)propan-2-ol |
|---|---|
| PubChem CID | 98454538 |
| Molecular Formula | C11H10F14O3 |
| Molecular Weight | 456.17 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 1,3-bis(2,2,3,3,4,4,4-heptafluorobutoxy)propan-2-ol |
| SMILES | OC(COCC(F)(F)C(F)(F)C(F)(F)F)COCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H10F14O3/c12-6(13,8(16,17)10(20,21)22)3-27-1-5(26)2-28-4-7(14,15)9(18,19)11(23,24)25/h5,26H,1-4H2 |
| InChIKey | VLFHADDJTCJDHD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.17 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|