C7H6F10O3 — CID 10947417
3,3,4-Trifluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)butane-1,2-diol (PubChem CID 10947417) has the molecular formula C7H6F10O3 and a molecular weight of 328.10 g/mol. Its IUPAC name is 3,3,4-trifluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)butane-1,2-diol.
| Compound Name | 3,3,4-Trifluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)butane-1,2-diol |
|---|---|
| PubChem CID | 10947417 |
| Molecular Formula | C7H6F10O3 |
| Molecular Weight | 328.10 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 3,3,4-trifluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)butane-1,2-diol |
| SMILES | C(C(C(C(OC(C(C(F)(F)F)(F)F)(F)F)F)(F)F)O)O |
| InChI | InChI=1S/C7H6F10O3/c8-3(4(9,10)2(19)1-18)20-7(16,17)5(11,12)6(13,14)15/h2-3,18-19H,1H2 |
| InChIKey | HVUJLWXAFKEELB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | 327 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.10 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|