C7H6F10O3 — CID 19023876
2,2,3,3,4,4-hexafluoro-4-(1,1,1,2-tetrafluoro-3-hydroxypropan-2-yl)oxybutan-1-ol (PubChem CID 19023876) has the molecular formula C7H6F10O3 and a molecular weight of 328.10 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-4-(1,1,1,2-tetrafluoro-3-hydroxypropan-2-yl)oxybutan-1-ol.
| Compound Name | 2,2,3,3,4,4-hexafluoro-4-(1,1,1,2-tetrafluoro-3-hydroxypropan-2-yl)oxybutan-1-ol |
|---|---|
| PubChem CID | 19023876 |
| Molecular Formula | C7H6F10O3 |
| Molecular Weight | 328.10 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-4-(1,1,1,2-tetrafluoro-3-hydroxypropan-2-yl)oxybutan-1-ol |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)OC(F)(CO)C(F)(F)F |
| InChI | InChI=1S/C7H6F10O3/c8-3(9,1-18)5(11,12)7(16,17)20-4(10,2-19)6(13,14)15/h18-19H,1-2H2 |
| InChIKey | XURNIPGSKZPHGX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.10 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|