C10H6F16O4 — CID 15472349
3,3,4-trifluoro-4-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]butane-1,2-diol (PubChem CID 15472349) has the molecular formula C10H6F16O4 and a molecular weight of 494.12 g/mol. Its IUPAC name is 3,3,4-trifluoro-4-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]butane-1,2-diol.
| Compound Name | 3,3,4-trifluoro-4-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]butane-1,2-diol |
|---|---|
| PubChem CID | 15472349 |
| Molecular Formula | C10H6F16O4 |
| Molecular Weight | 494.12 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | 3,3,4-trifluoro-4-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]butane-1,2-diol |
| SMILES | OCC(O)C(F)(F)C(F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H6F16O4/c11-3(4(12,13)2(28)1-27)29-10(25,26)6(16,8(20,21)22)30-9(23,24)5(14,15)7(17,18)19/h2-3,27-28H,1H2 |
| InChIKey | WJUTYBQSFFJGMJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.12 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|