C14H10F20O4S2 — CID 121432787
1,4-bis[[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanyl]butane-2,3-diol (PubChem CID 121432787) has the molecular formula C14H10F20O4S2 and a molecular weight of 686.32 g/mol. Its IUPAC name is 1,4-bis[[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanyl]butane-2,3-diol.
| Compound Name | 1,4-bis[[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanyl]butane-2,3-diol |
|---|---|
| PubChem CID | 121432787 |
| Molecular Formula | C14H10F20O4S2 |
| Molecular Weight | 686.32 g/mol |
| Exact Mass | 685.97 |
| IUPAC Name | 1,4-bis[[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanyl]butane-2,3-diol |
| SMILES | OC(CSC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F)C(O)CSC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H10F20O4S2/c15-5(37-13(31,32)9(21,22)11(25,26)27)7(17,18)39-1-3(35)4(36)2-40-8(19,20)6(16)38-14(33,34)10(23,24)12(28,29)30/h3-6,35-36H,1-2H2 |
| InChIKey | XASWXZQUQMAOGX-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.32 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|