C16H10F20O6 — CID 162752844
1,3-bis[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]propan-2-yl prop-2-enoate (PubChem CID 162752844) has the molecular formula C16H10F20O6 and a molecular weight of 678.21 g/mol. Its IUPAC name is 1,3-bis[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]propan-2-yl prop-2-enoate.
| Compound Name | 1,3-bis[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]propan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 162752844 |
| Molecular Formula | C16H10F20O6 |
| Molecular Weight | 678.21 g/mol |
| Exact Mass | 678.02 |
| IUPAC Name | 1,3-bis[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]propan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(COC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F)COC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H10F20O6/c1-2-6(37)40-5(3-38-9(19,20)7(17)41-15(33,34)11(23,24)13(27,28)29)4-39-10(21,22)8(18)42-16(35,36)12(25,26)14(30,31)32/h2,5,7-8H,1,3-4H2 |
| InChIKey | LTATXKPYYOMJJR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.21 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|