C11H10F10O4 — CID 162752846
2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]propyl prop-2-enoate (PubChem CID 162752846) has the molecular formula C11H10F10O4 and a molecular weight of 396.18 g/mol. Its IUPAC name is 2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]propyl prop-2-enoate.
| Compound Name | 2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 162752846 |
| Molecular Formula | C11H10F10O4 |
| Molecular Weight | 396.18 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)OC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H10F10O4/c1-3-6(22)23-4-5(2)24-8(13,14)7(12)25-11(20,21)9(15,16)10(17,18)19/h3,5,7H,1,4H2,2H3 |
| InChIKey | NCOAYMKGOKEOQM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.18 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|