C10H10F6O4 — CID 170086005
1,1,1,3,3,3-hexafluoropropan-2-yl 2-methyl-3-prop-2-enoyloxypropanoate (PubChem CID 170086005) has the molecular formula C10H10F6O4 and a molecular weight of 308.17 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-methyl-3-prop-2-enoyloxypropanoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-methyl-3-prop-2-enoyloxypropanoate |
|---|---|
| PubChem CID | 170086005 |
| Molecular Formula | C10H10F6O4 |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-methyl-3-prop-2-enoyloxypropanoate |
| SMILES | C=CC(=O)OCC(C)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F6O4/c1-3-6(17)19-4-5(2)7(18)20-8(9(11,12)13)10(14,15)16/h3,5,8H,1,4H2,2H3 |
| InChIKey | OTTUCGHFDGSMKJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|