C7H11O7P — CID 174544812
phosphono 2-methyl-3-prop-2-enoyloxypropanoate (PubChem CID 174544812) has the molecular formula C7H11O7P and a molecular weight of 238.13 g/mol. Its IUPAC name is phosphono 2-methyl-3-prop-2-enoyloxypropanoate.
| Compound Name | phosphono 2-methyl-3-prop-2-enoyloxypropanoate |
|---|---|
| PubChem CID | 174544812 |
| Molecular Formula | C7H11O7P |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | phosphono 2-methyl-3-prop-2-enoyloxypropanoate |
| SMILES | C=CC(=O)OCC(C)C(=O)OP(=O)(O)O |
| InChI | InChI=1S/C7H11O7P/c1-3-6(8)13-4-5(2)7(9)14-15(10,11)12/h3,5H,1,4H2,2H3,(H2,10,11,12) |
| InChIKey | OXDYETHJTKWGBF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|