C15H22O6 — CID 58805573
[3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] 2-methylbutanoate (PubChem CID 58805573) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is [3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] 2-methylbutanoate.
| Compound Name | [3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 58805573 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] 2-methylbutanoate |
| SMILES | C=CC(=O)OCC(COC(=O)C=C)COC(=O)C(C)CC |
| InChI | InChI=1S/C15H22O6/c1-5-11(4)15(18)21-10-12(8-19-13(16)6-2)9-20-14(17)7-3/h6-7,11-12H,2-3,5,8-10H2,1,4H3 |
| InChIKey | CLXBZKICPTXSBZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|