C14H24O4 — CID 161178594
3-methyl-2-methylidenepentanoic acid;2-methylpropyl prop-2-enoate (PubChem CID 161178594) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is 3-methyl-2-methylidenepentanoic acid;2-methylpropyl prop-2-enoate.
| Compound Name | 3-methyl-2-methylidenepentanoic acid;2-methylpropyl prop-2-enoate |
|---|---|
| PubChem CID | 161178594 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 3-methyl-2-methylidenepentanoic acid;2-methylpropyl prop-2-enoate |
| SMILES | C=C(C(=O)O)C(C)CC.C=CC(=O)OCC(C)C |
| InChI | InChI=1S/2C7H12O2/c1-4-7(8)9-5-6(2)3;1-4-5(2)6(3)7(8)9/h4,6H,1,5H2,2-3H3;5H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | USDIUAYAHJLUOD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|