2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid

C12H21NO4 — CID 158771008

IUPAC2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid
SMILESC=C(C)C(=O)O.C=CC(=O)OCC(C)N(C)C
InChIInChI=1S/C8H15NO2.C4H6O2/c1-5-8(10)11-6-7(2)9(3)4;1-3(2)4(5)6/h5,7H,1,6H2,2-4H3;1H2,2H3,(H,5,6)
InChIKeyIPWBYOFXLCSDOB-UHFFFAOYSA-N
MW243.30 g/mol
LogP1.31
Rot. Bonds5

About 2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid

2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 158771008) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid.

Molecular Properties

Compound Name2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid
PubChem CID158771008
Molecular FormulaC12H21NO4
Molecular Weight243.30 g/mol
Exact Mass243.15
IUPAC Name2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid
SMILESC=C(C)C(=O)O.C=CC(=O)OCC(C)N(C)C
InChIInChI=1S/C8H15NO2.C4H6O2/c1-5-8(10)11-6-7(2)9(3)4;1-3(2)4(5)6/h5,7H,1,6H2,2-4H3;1H2,2H3,(H,5,6)
InChIKeyIPWBYOFXLCSDOB-UHFFFAOYSA-N
XLogP1.31
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.30
LogP ≤ 51.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid?
The IUPAC name of 2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid (CID 158771008) is 2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid.
What is the SMILES notation for 2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid?
The canonical SMILES for 2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid is C=C(C)C(=O)O.C=CC(=O)OCC(C)N(C)C.
What is the InChIKey of 2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid?
The InChIKey is IPWBYOFXLCSDOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C4H6O2/c1-5-8(10)11-6-7(2)9(3)4;1-3(2)4(5)6/h5,7H,1,6H2,2-4H3;1H2,2H3,(H,5,6).
What are the key properties of 2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid?
2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid has a molecular weight of 243.30 g/mol, XLogP of 1.31, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)propyl prop-2-enoate;2-methylprop-2-enoic acid is sourced from PubChem (CID 158771008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).