C13H19NO5 — CID 87208594
2-methylprop-2-enoic acid;prop-2-enamide;prop-2-enyl prop-2-enoate (PubChem CID 87208594) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;prop-2-enamide;prop-2-enyl prop-2-enoate.
| Compound Name | 2-methylprop-2-enoic acid;prop-2-enamide;prop-2-enyl prop-2-enoate |
|---|---|
| PubChem CID | 87208594 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-methylprop-2-enoic acid;prop-2-enamide;prop-2-enyl prop-2-enoate |
| SMILES | C=C(C)C(=O)O.C=CC(N)=O.C=CCOC(=O)C=C |
| InChI | InChI=1S/C6H8O2.C4H6O2.C3H5NO/c1-3-5-8-6(7)4-2;1-3(2)4(5)6;1-2-3(4)5/h3-4H,1-2,5H2;1H2,2H3,(H,5,6);2H,1H2,(H2,4,5) |
| InChIKey | LKPFZKSHECXUCJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|