C10H17NO5 — CID 174950031
(3-amino-2-hydroxypropyl) prop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 174950031) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is (3-amino-2-hydroxypropyl) prop-2-enoate;2-methylprop-2-enoic acid.
| Compound Name | (3-amino-2-hydroxypropyl) prop-2-enoate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 174950031 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (3-amino-2-hydroxypropyl) prop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=CC(=O)OCC(O)CN |
| InChI | InChI=1S/C6H11NO3.C4H6O2/c1-2-6(9)10-4-5(8)3-7;1-3(2)4(5)6/h2,5,8H,1,3-4,7H2;1H2,2H3,(H,5,6) |
| InChIKey | VRQQERSOWBNDCX-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|