C14H23NO6 — CID 160685557
(2-hydroxy-3-prop-2-enoyloxypropyl) 2-methylprop-2-enoate;methane;prop-2-enamide (PubChem CID 160685557) has the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. Its IUPAC name is (2-hydroxy-3-prop-2-enoyloxypropyl) 2-methylprop-2-enoate;methane;prop-2-enamide.
| Compound Name | (2-hydroxy-3-prop-2-enoyloxypropyl) 2-methylprop-2-enoate;methane;prop-2-enamide |
|---|---|
| PubChem CID | 160685557 |
| Molecular Formula | C14H23NO6 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (2-hydroxy-3-prop-2-enoyloxypropyl) 2-methylprop-2-enoate;methane;prop-2-enamide |
| SMILES | C.C=CC(=O)OCC(O)COC(=O)C(=C)C.C=CC(N)=O |
| InChI | InChI=1S/C10H14O5.C3H5NO.CH4/c1-4-9(12)14-5-8(11)6-15-10(13)7(2)3;1-2-3(4)5;/h4,8,11H,1-2,5-6H2,3H3;2H,1H2,(H2,4,5);1H4 |
| InChIKey | ROSGIVMNXJGLGR-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|