C18H30O9 — CID 174939081
ethanol;2-hydroxyethyl 2-methylprop-2-enoate;(2-hydroxy-3-prop-2-enoyloxypropyl) 2-methylprop-2-enoate (PubChem CID 174939081) has the molecular formula C18H30O9 and a molecular weight of 390.43 g/mol. Its IUPAC name is ethanol;2-hydroxyethyl 2-methylprop-2-enoate;(2-hydroxy-3-prop-2-enoyloxypropyl) 2-methylprop-2-enoate.
| Compound Name | ethanol;2-hydroxyethyl 2-methylprop-2-enoate;(2-hydroxy-3-prop-2-enoyloxypropyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174939081 |
| Molecular Formula | C18H30O9 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | ethanol;2-hydroxyethyl 2-methylprop-2-enoate;(2-hydroxy-3-prop-2-enoyloxypropyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCO.C=CC(=O)OCC(O)COC(=O)C(=C)C.CCO |
| InChI | InChI=1S/C10H14O5.C6H10O3.C2H6O/c1-4-9(12)14-5-8(11)6-15-10(13)7(2)3;1-5(2)6(8)9-4-3-7;1-2-3/h4,8,11H,1-2,5-6H2,3H3;7H,1,3-4H2,2H3;3H,2H2,1H3 |
| InChIKey | JBOFUFYWUYVGEG-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|