C10H14O4 — CID 176752228
(3-buta-1,3-dien-2-yloxy-2-hydroxypropyl) prop-2-enoate (PubChem CID 176752228) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (3-buta-1,3-dien-2-yloxy-2-hydroxypropyl) prop-2-enoate.
| Compound Name | (3-buta-1,3-dien-2-yloxy-2-hydroxypropyl) prop-2-enoate |
|---|---|
| PubChem CID | 176752228 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (3-buta-1,3-dien-2-yloxy-2-hydroxypropyl) prop-2-enoate |
| SMILES | C=CC(=C)OCC(O)COC(=O)C=C |
| InChI | InChI=1S/C10H14O4/c1-4-8(3)13-6-9(11)7-14-10(12)5-2/h4-5,9,11H,1-3,6-7H2 |
| InChIKey | MFIBLAHJIJBITO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|