C17H30O5 — CID 123574852
(2-hydroxy-3-prop-2-enoyloxypropyl) 2-tert-butyl-2,3,3-trimethylbutanoate (PubChem CID 123574852) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is (2-hydroxy-3-prop-2-enoyloxypropyl) 2-tert-butyl-2,3,3-trimethylbutanoate.
| Compound Name | (2-hydroxy-3-prop-2-enoyloxypropyl) 2-tert-butyl-2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 123574852 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (2-hydroxy-3-prop-2-enoyloxypropyl) 2-tert-butyl-2,3,3-trimethylbutanoate |
| SMILES | C=CC(=O)OCC(O)COC(=O)C(C)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H30O5/c1-9-13(19)21-10-12(18)11-22-14(20)17(8,15(2,3)4)16(5,6)7/h9,12,18H,1,10-11H2,2-8H3 |
| InChIKey | YPQZKAPWOKOWOJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|