C9H18ClNO3 — CID 87225254
(3-chloro-2-hydroxypropyl) prop-2-enoate;N,N-dimethylmethanamine (PubChem CID 87225254) has the molecular formula C9H18ClNO3 and a molecular weight of 223.70 g/mol. Its IUPAC name is (3-chloro-2-hydroxypropyl) prop-2-enoate;N,N-dimethylmethanamine.
| Compound Name | (3-chloro-2-hydroxypropyl) prop-2-enoate;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 87225254 |
| Molecular Formula | C9H18ClNO3 |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (3-chloro-2-hydroxypropyl) prop-2-enoate;N,N-dimethylmethanamine |
| SMILES | C=CC(=O)OCC(O)CCl.CN(C)C |
| InChI | InChI=1S/C6H9ClO3.C3H9N/c1-2-6(9)10-4-5(8)3-7;1-4(2)3/h2,5,8H,1,3-4H2;1-3H3 |
| InChIKey | OPXSRMWNDLWONJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|