C12H24ClNO3 — CID 87225352
(3-chloro-2-hydroxypropyl) prop-2-enoate;N,N-diethylethanamine (PubChem CID 87225352) has the molecular formula C12H24ClNO3 and a molecular weight of 265.78 g/mol. Its IUPAC name is (3-chloro-2-hydroxypropyl) prop-2-enoate;N,N-diethylethanamine.
| Compound Name | (3-chloro-2-hydroxypropyl) prop-2-enoate;N,N-diethylethanamine |
|---|---|
| PubChem CID | 87225352 |
| Molecular Formula | C12H24ClNO3 |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | (3-chloro-2-hydroxypropyl) prop-2-enoate;N,N-diethylethanamine |
| SMILES | C=CC(=O)OCC(O)CCl.CCN(CC)CC |
| InChI | InChI=1S/C6H9ClO3.C6H15N/c1-2-6(9)10-4-5(8)3-7;1-4-7(5-2)6-3/h2,5,8H,1,3-4H2;4-6H2,1-3H3 |
| InChIKey | OFNPFUXWJGFTHC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|