C16H26ClNO6 — CID 88514194
(3-chloro-2-hydroxypropyl) prop-2-enoate;2-methyl-5-oxohex-2-enamide;propan-2-one (PubChem CID 88514194) has the molecular formula C16H26ClNO6 and a molecular weight of 363.84 g/mol. Its IUPAC name is (3-chloro-2-hydroxypropyl) prop-2-enoate;2-methyl-5-oxohex-2-enamide;propan-2-one.
| Compound Name | (3-chloro-2-hydroxypropyl) prop-2-enoate;2-methyl-5-oxohex-2-enamide;propan-2-one |
|---|---|
| PubChem CID | 88514194 |
| Molecular Formula | C16H26ClNO6 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (3-chloro-2-hydroxypropyl) prop-2-enoate;2-methyl-5-oxohex-2-enamide;propan-2-one |
| SMILES | C=CC(=O)OCC(O)CCl.CC(=O)CC=C(C)C(N)=O.CC(C)=O |
| InChI | InChI=1S/C7H11NO2.C6H9ClO3.C3H6O/c1-5(7(8)10)3-4-6(2)9;1-2-6(9)10-4-5(8)3-7;1-3(2)4/h3H,4H2,1-2H3,(H2,8,10);2,5,8H,1,3-4H2;1-2H3 |
| InChIKey | VFIYTTXNZKTJTA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|