C12H20O5 — CID 173498844
[2-hydroxy-3-[(Z)-1-hydroxy-2,3-dimethylbut-1-enoxy]propyl] prop-2-enoate (PubChem CID 173498844) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is [2-hydroxy-3-[(Z)-1-hydroxy-2,3-dimethylbut-1-enoxy]propyl] prop-2-enoate.
| Compound Name | [2-hydroxy-3-[(Z)-1-hydroxy-2,3-dimethylbut-1-enoxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 173498844 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | [2-hydroxy-3-[(Z)-1-hydroxy-2,3-dimethylbut-1-enoxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)CO/C(O)=C(/C)C(C)C |
| InChI | InChI=1S/C12H20O5/c1-5-11(14)16-6-10(13)7-17-12(15)9(4)8(2)3/h5,8,10,13,15H,1,6-7H2,2-4H3/b12-9- |
| InChIKey | UMCQGPGLROAZTI-XFXZXTDPSA-N |
| XLogP | 1.54 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|