About [3-(diethylamino)-2-hydroxypropyl] prop-2-enoate;hydroiodide
[3-(diethylamino)-2-hydroxypropyl] prop-2-enoate;hydroiodide (PubChem CID 173034906) has the molecular formula C10H20INO3
and a molecular weight of 329.18 g/mol. Its IUPAC name is [3-(diethylamino)-2-hydroxypropyl] prop-2-enoate;hydroiodide.
Molecular Properties
| Compound Name | [3-(diethylamino)-2-hydroxypropyl] prop-2-enoate;hydroiodide |
| PubChem CID | 173034906 |
| Molecular Formula | C10H20INO3 |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | [3-(diethylamino)-2-hydroxypropyl] prop-2-enoate;hydroiodide |
| SMILES | C=CC(=O)OCC(O)CN(CC)CC.I |
| InChI | InChI=1S/C10H19NO3.HI/c1-4-10(13)14-8-9(12)7-11(5-2)6-3;/h4,9,12H,1,5-8H2,2-3H3;1H |
| InChIKey | NSAIYSLFHNIDKJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(diethylamino)-2-hydroxypropyl] prop-2-enoate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(diethylamino)-2-hydroxypropyl] prop-2-enoate;hydroiodide?
The IUPAC name of [3-(diethylamino)-2-hydroxypropyl] prop-2-enoate;hydroiodide (CID 173034906) is [3-(diethylamino)-2-hydroxypropyl] prop-2-enoate;hydroiodide.
What is the SMILES notation for [3-(diethylamino)-2-hydroxypropyl] prop-2-enoate;hydroiodide?
The canonical SMILES for [3-(diethylamino)-2-hydroxypropyl] prop-2-enoate;hydroiodide is C=CC(=O)OCC(O)CN(CC)CC.I.
What is the InChIKey of [3-(diethylamino)-2-hydroxypropyl] prop-2-enoate;hydroiodide?
The InChIKey is NSAIYSLFHNIDKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3.HI/c1-4-10(13)14-8-9(12)7-11(5-2)6-3;/h4,9,12H,1,5-8H2,2-3H3;1H.
What are the key properties of [3-(diethylamino)-2-hydroxypropyl] prop-2-enoate;hydroiodide?
[3-(diethylamino)-2-hydroxypropyl] prop-2-enoate;hydroiodide has a molecular weight of 329.18 g/mol, XLogP of 1.04, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(diethylamino)-2-hydroxypropyl] prop-2-enoate;hydroiodide is sourced from PubChem (CID 173034906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).