C24H42O9 — CID 146525602
[2-hydroxy-3-(4-prop-2-enoyloxybutoxy)propyl] 3-(3-hex-5-enoxy-2-hydroxypropoxy)-2,2-dimethylpropanoate (PubChem CID 146525602) has the molecular formula C24H42O9 and a molecular weight of 474.59 g/mol. Its IUPAC name is [2-hydroxy-3-(4-prop-2-enoyloxybutoxy)propyl] 3-(3-hex-5-enoxy-2-hydroxypropoxy)-2,2-dimethylpropanoate.
| Compound Name | [2-hydroxy-3-(4-prop-2-enoyloxybutoxy)propyl] 3-(3-hex-5-enoxy-2-hydroxypropoxy)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146525602 |
| Molecular Formula | C24H42O9 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | [2-hydroxy-3-(4-prop-2-enoyloxybutoxy)propyl] 3-(3-hex-5-enoxy-2-hydroxypropoxy)-2,2-dimethylpropanoate |
| SMILES | C=CCCCCOCC(O)COCC(C)(C)C(=O)OCC(O)COCCCCOC(=O)C=C |
| InChI | InChI=1S/C24H42O9/c1-5-7-8-9-12-29-15-20(25)17-31-19-24(3,4)23(28)33-18-21(26)16-30-13-10-11-14-32-22(27)6-2/h5-6,20-21,25-26H,1-2,7-19H2,3-4H3 |
| InChIKey | LFHCJWJEOCVEDD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|