C13H24O8 — CID 18346271
[2-hydroxy-3-[2-[2-hydroxy-2-(2-hydroxyethoxy)propoxy]ethoxy]propyl] prop-2-enoate (PubChem CID 18346271) has the molecular formula C13H24O8 and a molecular weight of 308.33 g/mol. Its IUPAC name is [2-hydroxy-3-[2-[2-hydroxy-2-(2-hydroxyethoxy)propoxy]ethoxy]propyl] prop-2-enoate.
| Compound Name | [2-hydroxy-3-[2-[2-hydroxy-2-(2-hydroxyethoxy)propoxy]ethoxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 18346271 |
| Molecular Formula | C13H24O8 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | [2-hydroxy-3-[2-[2-hydroxy-2-(2-hydroxyethoxy)propoxy]ethoxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)COCCOCC(C)(O)OCCO |
| InChI | InChI=1S/C13H24O8/c1-3-12(16)20-9-11(15)8-18-6-7-19-10-13(2,17)21-5-4-14/h3,11,14-15,17H,1,4-10H2,2H3 |
| InChIKey | SRALENMSPGRPRT-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|