C14H32O5Si — CID 158252465
[2-hydroxy-3-[3-[methoxy(dimethyl)silyl]propoxy]propyl] prop-2-enoate;methane (PubChem CID 158252465) has the molecular formula C14H32O5Si and a molecular weight of 308.49 g/mol. Its IUPAC name is [2-hydroxy-3-[3-[methoxy(dimethyl)silyl]propoxy]propyl] prop-2-enoate;methane.
| Compound Name | [2-hydroxy-3-[3-[methoxy(dimethyl)silyl]propoxy]propyl] prop-2-enoate;methane |
|---|---|
| PubChem CID | 158252465 |
| Molecular Formula | C14H32O5Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | [2-hydroxy-3-[3-[methoxy(dimethyl)silyl]propoxy]propyl] prop-2-enoate;methane |
| SMILES | C.C.C=CC(=O)OCC(O)COCCC[Si](C)(C)OC |
| InChI | InChI=1S/C12H24O5Si.2CH4/c1-5-12(14)17-10-11(13)9-16-7-6-8-18(3,4)15-2;;/h5,11,13H,1,6-10H2,2-4H3;2*1H4 |
| InChIKey | GGWPQFPIVRHDTH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|