C15H26O6 — CID 154601558
[2-hydroxy-3-[6-(oxiran-2-ylmethoxy)hexoxy]propyl] prop-2-enoate (PubChem CID 154601558) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is [2-hydroxy-3-[6-(oxiran-2-ylmethoxy)hexoxy]propyl] prop-2-enoate.
| Compound Name | [2-hydroxy-3-[6-(oxiran-2-ylmethoxy)hexoxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 154601558 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | [2-hydroxy-3-[6-(oxiran-2-ylmethoxy)hexoxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)COCCCCCCOCC1CO1 |
| InChI | InChI=1S/C15H26O6/c1-2-15(17)21-10-13(16)9-18-7-5-3-4-6-8-19-11-14-12-20-14/h2,13-14,16H,1,3-12H2 |
| InChIKey | ZHDVFBHSYPAEDR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|