C20H38O10Rf-2 — CID 177273640
bis(1-methanidyloxy-3-[3-(oxiran-2-ylmethoxy)propoxy]propan-2-ol);rutherfordium (PubChem CID 177273640) has the molecular formula C20H38O10Rf-2 and a molecular weight of 705.51 g/mol. Its IUPAC name is bis(1-methanidyloxy-3-[3-(oxiran-2-ylmethoxy)propoxy]propan-2-ol);rutherfordium.
| Compound Name | bis(1-methanidyloxy-3-[3-(oxiran-2-ylmethoxy)propoxy]propan-2-ol);rutherfordium |
|---|---|
| PubChem CID | 177273640 |
| Molecular Formula | C20H38O10Rf-2 |
| Molecular Weight | 705.51 g/mol |
| Exact Mass | 705.37 |
| IUPAC Name | bis(1-methanidyloxy-3-[3-(oxiran-2-ylmethoxy)propoxy]propan-2-ol);rutherfordium |
| SMILES | [CH2-]OCC(O)COCCCOCC1CO1.[CH2-]OCC(O)COCCCOCC1CO1.[Rf] |
| InChI | InChI=1S/2C10H19O5.Rf/c2*1-12-5-9(11)6-13-3-2-4-14-7-10-8-15-10;/h2*9-11H,1-8H2;/q2*-1; |
| InChIKey | DKAJLAQPOIMVKT-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.51 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|