C13H22O6 — CID 22604997
[2-hydroxy-3-[4-(oxiran-2-ylmethoxy)butoxy]propyl] prop-2-enoate (PubChem CID 22604997) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is [2-hydroxy-3-[4-(oxiran-2-ylmethoxy)butoxy]propyl] prop-2-enoate.
| Compound Name | [2-hydroxy-3-[4-(oxiran-2-ylmethoxy)butoxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 22604997 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | [2-hydroxy-3-[4-(oxiran-2-ylmethoxy)butoxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)COCCCCOCC1CO1 |
| InChI | InChI=1S/C13H22O6/c1-2-13(15)19-8-11(14)7-16-5-3-4-6-17-9-12-10-18-12/h2,11-12,14H,1,3-10H2 |
| InChIKey | VZTBPNRTJCPFFU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|