C11H19NO3 — CID 18188386
N-[5-(oxiran-2-ylmethoxy)pentyl]prop-2-enamide (PubChem CID 18188386) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is N-[5-(oxiran-2-ylmethoxy)pentyl]prop-2-enamide.
| Compound Name | N-[5-(oxiran-2-ylmethoxy)pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 18188386 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | N-[5-(oxiran-2-ylmethoxy)pentyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCCCOCC1CO1 |
| InChI | InChI=1S/C11H19NO3/c1-2-11(13)12-6-4-3-5-7-14-8-10-9-15-10/h2,10H,1,3-9H2,(H,12,13) |
| InChIKey | CDJQLDOSFSALHP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|