C23H42N2O6 — CID 88622123
N,N'-bis[4-(oxiran-2-ylmethoxy)butyl]nonanediamide (PubChem CID 88622123) has the molecular formula C23H42N2O6 and a molecular weight of 442.60 g/mol. Its IUPAC name is N,N'-bis[4-(oxiran-2-ylmethoxy)butyl]nonanediamide.
| Compound Name | N,N'-bis[4-(oxiran-2-ylmethoxy)butyl]nonanediamide |
|---|---|
| PubChem CID | 88622123 |
| Molecular Formula | C23H42N2O6 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | N,N'-bis[4-(oxiran-2-ylmethoxy)butyl]nonanediamide |
| SMILES | O=C(CCCCCCCC(=O)NCCCCOCC1CO1)NCCCCOCC1CO1 |
| InChI | InChI=1S/C23H42N2O6/c26-22(24-12-6-8-14-28-16-20-18-30-20)10-4-2-1-3-5-11-23(27)25-13-7-9-15-29-17-21-19-31-21/h20-21H,1-19H2,(H,24,26)(H,25,27) |
| InChIKey | SHWFRHRTYAYIRU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|