C13H23NO7 — CID 137319794
4-[2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]ethylamino]-4-oxobutanoic acid (PubChem CID 137319794) has the molecular formula C13H23NO7 and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-[2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 137319794 |
| Molecular Formula | C13H23NO7 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 4-[2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]ethylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCCOCCOCCOCC1CO1 |
| InChI | InChI=1S/C13H23NO7/c15-12(1-2-13(16)17)14-3-4-18-5-6-19-7-8-20-9-11-10-21-11/h11H,1-10H2,(H,14,15)(H,16,17) |
| InChIKey | IRQBKPXFMOEQNL-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|