C11H20N2O5 — CID 89261056
1,3-bis[2-(oxiran-2-ylmethoxy)ethyl]urea (PubChem CID 89261056) has the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. Its IUPAC name is 1,3-bis[2-(oxiran-2-ylmethoxy)ethyl]urea.
| Compound Name | 1,3-bis[2-(oxiran-2-ylmethoxy)ethyl]urea |
|---|---|
| PubChem CID | 89261056 |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 1,3-bis[2-(oxiran-2-ylmethoxy)ethyl]urea |
| SMILES | O=C(NCCOCC1CO1)NCCOCC1CO1 |
| InChI | InChI=1S/C11H20N2O5/c14-11(12-1-3-15-5-9-7-17-9)13-2-4-16-6-10-8-18-10/h9-10H,1-8H2,(H2,12,13,14) |
| InChIKey | HRMYEOOFQBFNSO-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|