C12H21NO3 — CID 140901902
2-methyl-N-[5-(oxiran-2-ylmethoxy)pentyl]prop-2-enamide (PubChem CID 140901902) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 2-methyl-N-[5-(oxiran-2-ylmethoxy)pentyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[5-(oxiran-2-ylmethoxy)pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 140901902 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-methyl-N-[5-(oxiran-2-ylmethoxy)pentyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCCCOCC1CO1 |
| InChI | InChI=1S/C12H21NO3/c1-10(2)12(14)13-6-4-3-5-7-15-8-11-9-16-11/h11H,1,3-9H2,2H3,(H,13,14) |
| InChIKey | PVDDBXXIWAAUTK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|