C13H30O5Si3 — CID 150144614
3-[[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl prop-2-enoate (PubChem CID 150144614) has the molecular formula C13H30O5Si3 and a molecular weight of 350.64 g/mol. Its IUPAC name is 3-[[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl prop-2-enoate.
| Compound Name | 3-[[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 150144614 |
| Molecular Formula | C13H30O5Si3 |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 3-[[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)OC |
| InChI | InChI=1S/C13H30O5Si3/c1-9-13(14)16-11-10-12-19(3,4)17-21(7,8)18-20(5,6)15-2/h9H,1,10-12H2,2-8H3 |
| InChIKey | FDZIJOZGBTYMTN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|