C13H28O4Si2 — CID 140777511
1-[4-[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]butoxy]but-3-en-2-one (PubChem CID 140777511) has the molecular formula C13H28O4Si2 and a molecular weight of 304.54 g/mol. Its IUPAC name is 1-[4-[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]butoxy]but-3-en-2-one.
| Compound Name | 1-[4-[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]butoxy]but-3-en-2-one |
|---|---|
| PubChem CID | 140777511 |
| Molecular Formula | C13H28O4Si2 |
| Molecular Weight | 304.54 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-[4-[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]butoxy]but-3-en-2-one |
| SMILES | C=CC(=O)COCCCC[Si](C)(C)O[Si](C)(C)OC |
| InChI | InChI=1S/C13H28O4Si2/c1-7-13(14)12-16-10-8-9-11-18(3,4)17-19(5,6)15-2/h7H,1,8-12H2,2-6H3 |
| InChIKey | UGKVYGSDMDFUQN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|