C16H42O5Si4 — CID 162713129
hydroxy-[[[7-methoxyheptyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane (PubChem CID 162713129) has the molecular formula C16H42O5Si4 and a molecular weight of 426.85 g/mol. Its IUPAC name is hydroxy-[[[7-methoxyheptyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane.
| Compound Name | hydroxy-[[[7-methoxyheptyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 162713129 |
| Molecular Formula | C16H42O5Si4 |
| Molecular Weight | 426.85 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | hydroxy-[[[7-methoxyheptyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane |
| SMILES | COCCCCCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O |
| InChI | InChI=1S/C16H42O5Si4/c1-18-15-13-11-10-12-14-16-22(2,3)19-24(6,7)21-25(8,9)20-23(4,5)17/h17H,10-16H2,1-9H3 |
| InChIKey | ICYOTEQANPJOHD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.85 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|