C16H40O6Si3 — CID 58159183
2-[3-[[[3-(methoxymethoxy)propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethanol (PubChem CID 58159183) has the molecular formula C16H40O6Si3 and a molecular weight of 412.75 g/mol. Its IUPAC name is 2-[3-[[[3-(methoxymethoxy)propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethanol.
| Compound Name | 2-[3-[[[3-(methoxymethoxy)propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethanol |
|---|---|
| PubChem CID | 58159183 |
| Molecular Formula | C16H40O6Si3 |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 2-[3-[[[3-(methoxymethoxy)propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethanol |
| SMILES | COCOCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCOCCO |
| InChI | InChI=1S/C16H40O6Si3/c1-18-16-20-12-9-15-24(4,5)22-25(6,7)21-23(2,3)14-8-11-19-13-10-17/h17H,8-16H2,1-7H3 |
| InChIKey | QVGJREVKKRPLID-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|