C20H48O8Si3 — CID 59180551
2-[3-[[[bis[3-(2-hydroxyethoxy)propyl]-methylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethanol (PubChem CID 59180551) has the molecular formula C20H48O8Si3 and a molecular weight of 500.85 g/mol. Its IUPAC name is 2-[3-[[[bis[3-(2-hydroxyethoxy)propyl]-methylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethanol.
| Compound Name | 2-[3-[[[bis[3-(2-hydroxyethoxy)propyl]-methylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethanol |
|---|---|
| PubChem CID | 59180551 |
| Molecular Formula | C20H48O8Si3 |
| Molecular Weight | 500.85 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 2-[3-[[[bis[3-(2-hydroxyethoxy)propyl]-methylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethanol |
| SMILES | C[Si](C)(CCCOCCO)O[Si](C)(C)O[Si](C)(CCCOCCO)CCCOCCO |
| InChI | InChI=1S/C20H48O8Si3/c1-29(2,18-6-12-24-15-9-21)27-30(3,4)28-31(5,19-7-13-25-16-10-22)20-8-14-26-17-11-23/h21-23H,6-20H2,1-5H3 |
| InChIKey | OEICUGAARSYELM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.85 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|