C36H92O9Si9 — CID 59565854
7-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]-2,2-bis[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxymethyl]heptan-1-ol (PubChem CID 59565854) has the molecular formula C36H92O9Si9 and a molecular weight of 921.90 g/mol. Its IUPAC name is 7-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]-2,2-bis[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxymethyl]heptan-1-ol.
| Compound Name | 7-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]-2,2-bis[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxymethyl]heptan-1-ol |
|---|---|
| PubChem CID | 59565854 |
| Molecular Formula | C36H92O9Si9 |
| Molecular Weight | 921.90 g/mol |
| Exact Mass | 920.47 |
| IUPAC Name | 7-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]-2,2-bis[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxymethyl]heptan-1-ol |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCCCC(CO)(COCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C)COCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C36H92O9Si9/c1-46(2,3)40-52(16,17)43-49(10,11)30-24-22-23-27-36(33-37,34-38-28-25-31-50(12,13)44-53(18,19)41-47(4,5)6)35-39-29-26-32-51(14,15)45-54(20,21)42-48(7,8)9/h37H,22-35H2,1-21H3 |
| InChIKey | YATDBGSKQMVXKW-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.90 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|