C23H60O8Si6 — CID 153470020
2-[[methyl-bis(trimethylsilyloxy)silyl]methoxymethyl]-2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxymethyl]propane-1,3-diol (PubChem CID 153470020) has the molecular formula C23H60O8Si6 and a molecular weight of 633.24 g/mol. Its IUPAC name is 2-[[methyl-bis(trimethylsilyloxy)silyl]methoxymethyl]-2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxymethyl]propane-1,3-diol.
| Compound Name | 2-[[methyl-bis(trimethylsilyloxy)silyl]methoxymethyl]-2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxymethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 153470020 |
| Molecular Formula | C23H60O8Si6 |
| Molecular Weight | 633.24 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | 2-[[methyl-bis(trimethylsilyloxy)silyl]methoxymethyl]-2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxymethyl]propane-1,3-diol |
| SMILES | C[Si](C)(C)O[Si](C)(CCCOCC(CO)(CO)COC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C23H60O8Si6/c1-32(2,3)28-36(13,29-33(4,5)6)17-15-16-26-20-23(18-24,19-25)21-27-22-37(14,30-34(7,8)9)31-35(10,11)12/h24-25H,15-22H2,1-14H3 |
| InChIKey | FOWFHYMCHAUAHK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.24 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|