C15H38O5Si3 — CID 140891430
2-methyl-2-[4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,3-diol (PubChem CID 140891430) has the molecular formula C15H38O5Si3 and a molecular weight of 382.72 g/mol. Its IUPAC name is 2-methyl-2-[4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,3-diol.
| Compound Name | 2-methyl-2-[4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,3-diol |
|---|---|
| PubChem CID | 140891430 |
| Molecular Formula | C15H38O5Si3 |
| Molecular Weight | 382.72 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-methyl-2-[4-[methyl-bis(trimethylsilyloxy)silyl]butoxy]propane-1,3-diol |
| SMILES | CC(CO)(CO)OCCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H38O5Si3/c1-15(13-16,14-17)18-11-9-10-12-23(8,19-21(2,3)4)20-22(5,6)7/h16-17H,9-14H2,1-8H3 |
| InChIKey | ZPRIFLOJUUXDDF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.72 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|