C17H42O5Si3 — CID 140891436
2-ethyl-2-[5-[methyl-bis(trimethylsilyloxy)silyl]pentoxy]propane-1,3-diol (PubChem CID 140891436) has the molecular formula C17H42O5Si3 and a molecular weight of 410.78 g/mol. Its IUPAC name is 2-ethyl-2-[5-[methyl-bis(trimethylsilyloxy)silyl]pentoxy]propane-1,3-diol.
| Compound Name | 2-ethyl-2-[5-[methyl-bis(trimethylsilyloxy)silyl]pentoxy]propane-1,3-diol |
|---|---|
| PubChem CID | 140891436 |
| Molecular Formula | C17H42O5Si3 |
| Molecular Weight | 410.78 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2-ethyl-2-[5-[methyl-bis(trimethylsilyloxy)silyl]pentoxy]propane-1,3-diol |
| SMILES | CCC(CO)(CO)OCCCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H42O5Si3/c1-9-17(15-18,16-19)20-13-11-10-12-14-25(8,21-23(2,3)4)22-24(5,6)7/h18-19H,9-16H2,1-8H3 |
| InChIKey | SYMVULOPBKYSAM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.78 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|